C15H17NO2 — CID 94522375
(2R)-2-[methyl(naphthalen-1-ylmethyl)amino]propanoic acid (PubChem CID 94522375) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is (2R)-2-[methyl(naphthalen-1-ylmethyl)amino]propanoic acid.
| Compound Name | (2R)-2-[methyl(naphthalen-1-ylmethyl)amino]propanoic acid |
|---|---|
| PubChem CID | 94522375 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | (2R)-2-[methyl(naphthalen-1-ylmethyl)amino]propanoic acid |
| SMILES | C[C@H](C(=O)O)N(C)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C15H17NO2/c1-11(15(17)18)16(2)10-13-8-5-7-12-6-3-4-9-14(12)13/h3-9,11H,10H2,1-2H3,(H,17,18)/t11-/m1/s1 |
| InChIKey | SLULYOAJIBQCNB-LLVKDONJSA-N |
| XLogP | 2.74 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |