C18H22O2S — CID 23212908
2-(tert-butylsulfanylmethyl)-3-naphthalen-1-ylpropanoic acid (PubChem CID 23212908) has the molecular formula C18H22O2S and a molecular weight of 302.44 g/mol. Its IUPAC name is 2-(tert-butylsulfanylmethyl)-3-naphthalen-1-ylpropanoic acid.
| Compound Name | 2-(tert-butylsulfanylmethyl)-3-naphthalen-1-ylpropanoic acid |
|---|---|
| PubChem CID | 23212908 |
| Molecular Formula | C18H22O2S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 2-(tert-butylsulfanylmethyl)-3-naphthalen-1-ylpropanoic acid |
| SMILES | CC(C)(C)SCC(Cc1cccc2ccccc12)C(=O)O |
| InChI | InChI=1S/C18H22O2S/c1-18(2,3)21-12-15(17(19)20)11-14-9-6-8-13-7-4-5-10-16(13)14/h4-10,15H,11-12H2,1-3H3,(H,19,20) |
| InChIKey | LMVQSTVUSLXPHG-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |