C42H35N5O2 — CID 139650872
(2S)-3-phenyl-2-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methylamino]propanoic acid (PubChem CID 139650872) has the molecular formula C42H35N5O2 and a molecular weight of 641.78 g/mol. Its IUPAC name is (2S)-3-phenyl-2-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methylamino]propanoic acid.
| Compound Name | (2S)-3-phenyl-2-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 139650872 |
| Molecular Formula | C42H35N5O2 |
| Molecular Weight | 641.78 g/mol |
| Exact Mass | 641.28 |
| IUPAC Name | (2S)-3-phenyl-2-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methylamino]propanoic acid |
| SMILES | O=C(O)[C@H](Cc1ccccc1)NCc1ccc(-c2ccccc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C42H35N5O2/c48-41(49)39(29-31-15-5-1-6-16-31)43-30-32-25-27-33(28-26-32)37-23-13-14-24-38(37)40-44-45-46-47(40)42(34-17-7-2-8-18-34,35-19-9-3-10-20-35)36-21-11-4-12-22-36/h1-28,39,43H,29-30H2,(H,48,49)/t39-/m0/s1 |
| InChIKey | REGZJNPTOUREGL-KDXMTYKHSA-N |
| XLogP | 7.63 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.78 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|