C48H47N7O2 — CID 101041498
3-amino-3-methyl-N-[(2R)-1-oxo-1-[N-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]anilino]butan-2-yl]butanamide (PubChem CID 101041498) has the molecular formula C48H47N7O2 and a molecular weight of 753.95 g/mol. Its IUPAC name is 3-amino-3-methyl-N-[(2R)-1-oxo-1-[N-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]anilino]butan-2-yl]butanamide.
| Compound Name | 3-amino-3-methyl-N-[(2R)-1-oxo-1-[N-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]anilino]butan-2-yl]butanamide |
|---|---|
| PubChem CID | 101041498 |
| Molecular Formula | C48H47N7O2 |
| Molecular Weight | 753.95 g/mol |
| Exact Mass | 753.38 |
| IUPAC Name | 3-amino-3-methyl-N-[(2R)-1-oxo-1-[N-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]anilino]butan-2-yl]butanamide |
| SMILES | CC[C@@H](NC(=O)CC(C)(C)N)C(=O)N(Cc1ccc(-c2ccccc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C48H47N7O2/c1-4-43(50-44(56)33-47(2,3)49)46(57)54(40-25-15-8-16-26-40)34-35-29-31-36(32-30-35)41-27-17-18-28-42(41)45-51-52-53-55(45)48(37-19-9-5-10-20-37,38-21-11-6-12-22-38)39-23-13-7-14-24-39/h5-32,43H,4,33-34,49H2,1-3H3,(H,50,56)/t43-/m1/s1 |
| InChIKey | BUZUYDUMHGNCPP-VZUYHUTRSA-N |
| XLogP | 8.40 |
| TPSA | 119.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.95 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|