C39H33N5O — CID 139626458
3-oxo-2-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]hexanenitrile (PubChem CID 139626458) has the molecular formula C39H33N5O and a molecular weight of 587.73 g/mol. Its IUPAC name is 3-oxo-2-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]hexanenitrile.
| Compound Name | 3-oxo-2-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]hexanenitrile |
|---|---|
| PubChem CID | 139626458 |
| Molecular Formula | C39H33N5O |
| Molecular Weight | 587.73 g/mol |
| Exact Mass | 587.27 |
| IUPAC Name | 3-oxo-2-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]hexanenitrile |
| SMILES | CCCC(=O)C(C#N)Cc1ccc(-c2ccccc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C39H33N5O/c1-2-14-37(45)31(28-40)27-29-23-25-30(26-24-29)35-21-12-13-22-36(35)38-41-42-43-44(38)39(32-15-6-3-7-16-32,33-17-8-4-9-18-33)34-19-10-5-11-20-34/h3-13,15-26,31H,2,14,27H2,1H3 |
| InChIKey | FELPOONGCXLYDT-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 84.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.73 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|