C40H35N5O — CID 139626457
3-oxo-2-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]heptanenitrile (PubChem CID 139626457) has the molecular formula C40H35N5O and a molecular weight of 601.75 g/mol. Its IUPAC name is 3-oxo-2-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]heptanenitrile.
| Compound Name | 3-oxo-2-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]heptanenitrile |
|---|---|
| PubChem CID | 139626457 |
| Molecular Formula | C40H35N5O |
| Molecular Weight | 601.75 g/mol |
| Exact Mass | 601.28 |
| IUPAC Name | 3-oxo-2-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]heptanenitrile |
| SMILES | CCCCC(=O)C(C#N)Cc1ccc(-c2ccccc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C40H35N5O/c1-2-3-23-38(46)32(29-41)28-30-24-26-31(27-25-30)36-21-13-14-22-37(36)39-42-43-44-45(39)40(33-15-7-4-8-16-33,34-17-9-5-10-18-34)35-19-11-6-12-20-35/h4-22,24-27,32H,2-3,23,28H2,1H3 |
| InChIKey | ZSSWZRBLAOCKEZ-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 84.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.75 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|