C39H32N6O2 — CID 140986332
ethyl 2-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]-1H-imidazole-5-carboxylate (PubChem CID 140986332) has the molecular formula C39H32N6O2 and a molecular weight of 616.73 g/mol. Its IUPAC name is ethyl 2-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]-1H-imidazole-5-carboxylate.
| Compound Name | ethyl 2-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]-1H-imidazole-5-carboxylate |
|---|---|
| PubChem CID | 140986332 |
| Molecular Formula | C39H32N6O2 |
| Molecular Weight | 616.73 g/mol |
| Exact Mass | 616.26 |
| IUPAC Name | ethyl 2-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]-1H-imidazole-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(Cc2ccc(-c3ccccc3-c3nnnn3C(c3ccccc3)(c3ccccc3)c3ccccc3)cc2)[nH]1 |
| InChI | InChI=1S/C39H32N6O2/c1-2-47-38(46)35-27-40-36(41-35)26-28-22-24-29(25-23-28)33-20-12-13-21-34(33)37-42-43-44-45(37)39(30-14-6-3-7-15-30,31-16-8-4-9-17-31)32-18-10-5-11-19-32/h3-25,27H,2,26H2,1H3,(H,40,41) |
| InChIKey | LSLBVUQELMWQJM-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.73 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|