C44H42N6O3 — CID 70051467
[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl 2-butyl-5-(2-hydroxypropan-2-yl)-1H-imidazole-4-carboxylate (PubChem CID 70051467) has the molecular formula C44H42N6O3 and a molecular weight of 702.86 g/mol. Its IUPAC name is [4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl 2-butyl-5-(2-hydroxypropan-2-yl)-1H-imidazole-4-carboxylate.
| Compound Name | [4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl 2-butyl-5-(2-hydroxypropan-2-yl)-1H-imidazole-4-carboxylate |
|---|---|
| PubChem CID | 70051467 |
| Molecular Formula | C44H42N6O3 |
| Molecular Weight | 702.86 g/mol |
| Exact Mass | 702.33 |
| IUPAC Name | [4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl 2-butyl-5-(2-hydroxypropan-2-yl)-1H-imidazole-4-carboxylate |
| SMILES | CCCCc1nc(C(=O)OCc2ccc(-c3ccccc3-c3nnnn3C(c3ccccc3)(c3ccccc3)c3ccccc3)cc2)c(C(C)(C)O)[nH]1 |
| InChI | InChI=1S/C44H42N6O3/c1-4-5-25-38-45-39(40(46-38)43(2,3)52)42(51)53-30-31-26-28-32(29-27-31)36-23-15-16-24-37(36)41-47-48-49-50(41)44(33-17-9-6-10-18-33,34-19-11-7-12-20-34)35-21-13-8-14-22-35/h6-24,26-29,52H,4-5,25,30H2,1-3H3,(H,45,46) |
| InChIKey | HUAQHXBATMKOBK-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.86 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|