C44H42N6O3 — CID 54501662
[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl 1,2-diethyl-5-(2-hydroxypropan-2-yl)imidazole-4-carboxylate (PubChem CID 54501662) has the molecular formula C44H42N6O3 and a molecular weight of 702.86 g/mol. Its IUPAC name is [4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl 1,2-diethyl-5-(2-hydroxypropan-2-yl)imidazole-4-carboxylate.
| Compound Name | [4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl 1,2-diethyl-5-(2-hydroxypropan-2-yl)imidazole-4-carboxylate |
|---|---|
| PubChem CID | 54501662 |
| Molecular Formula | C44H42N6O3 |
| Molecular Weight | 702.86 g/mol |
| Exact Mass | 702.33 |
| IUPAC Name | [4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl 1,2-diethyl-5-(2-hydroxypropan-2-yl)imidazole-4-carboxylate |
| SMILES | CCc1nc(C(=O)OCc2ccc(-c3ccccc3-c3nnnn3C(c3ccccc3)(c3ccccc3)c3ccccc3)cc2)c(C(C)(C)O)n1CC |
| InChI | InChI=1S/C44H42N6O3/c1-5-38-45-39(40(43(3,4)52)49(38)6-2)42(51)53-30-31-26-28-32(29-27-31)36-24-16-17-25-37(36)41-46-47-48-50(41)44(33-18-10-7-11-19-33,34-20-12-8-13-21-34)35-22-14-9-15-23-35/h7-29,52H,5-6,30H2,1-4H3 |
| InChIKey | YCVZTSBSMWUGJC-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.86 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|