C44H41N7O2 — CID 19932986
ethyl 2-ethyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine-4-carboxylate (PubChem CID 19932986) has the molecular formula C44H41N7O2 and a molecular weight of 699.86 g/mol. Its IUPAC name is ethyl 2-ethyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine-4-carboxylate.
| Compound Name | ethyl 2-ethyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 19932986 |
| Molecular Formula | C44H41N7O2 |
| Molecular Weight | 699.86 g/mol |
| Exact Mass | 699.33 |
| IUPAC Name | ethyl 2-ethyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine-4-carboxylate |
| SMILES | CCOC(=O)C1NCCc2nc(CC)n(Cc3ccc(-c4ccccc4-c4nnnn4C(c4ccccc4)(c4ccccc4)c4ccccc4)cc3)c21 |
| InChI | InChI=1S/C44H41N7O2/c1-3-39-46-38-28-29-45-40(43(52)53-4-2)41(38)50(39)30-31-24-26-32(27-25-31)36-22-14-15-23-37(36)42-47-48-49-51(42)44(33-16-8-5-9-17-33,34-18-10-6-11-19-34)35-20-12-7-13-21-35/h5-27,40,45H,3-4,28-30H2,1-2H3 |
| InChIKey | PKUCZPWBGROVIH-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 99.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.86 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|