C46H43N7O3 — CID 67696406
methyl 5-acetyl-2-propyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]-6,7-dihydro-4H-imidazo[4,5-c]pyridine-4-carboxylate (PubChem CID 67696406) has the molecular formula C46H43N7O3 and a molecular weight of 741.90 g/mol. Its IUPAC name is methyl 5-acetyl-2-propyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]-6,7-dihydro-4H-imidazo[4,5-c]pyridine-4-carboxylate.
| Compound Name | methyl 5-acetyl-2-propyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]-6,7-dihydro-4H-imidazo[4,5-c]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 67696406 |
| Molecular Formula | C46H43N7O3 |
| Molecular Weight | 741.90 g/mol |
| Exact Mass | 741.34 |
| IUPAC Name | methyl 5-acetyl-2-propyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]-6,7-dihydro-4H-imidazo[4,5-c]pyridine-4-carboxylate |
| SMILES | CCCc1nc2c(n1Cc1ccc(-c3ccccc3-c3nnnn3C(c3ccccc3)(c3ccccc3)c3ccccc3)cc1)C(C(=O)OC)N(C(C)=O)CC2 |
| InChI | InChI=1S/C46H43N7O3/c1-4-16-41-47-40-29-30-51(32(2)54)43(45(55)56-3)42(40)52(41)31-33-25-27-34(28-26-33)38-23-14-15-24-39(38)44-48-49-50-53(44)46(35-17-8-5-9-18-35,36-19-10-6-11-20-36)37-21-12-7-13-22-37/h5-15,17-28,43H,4,16,29-31H2,1-3H3 |
| InChIKey | XFFBADXDDZLUBY-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 108.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.90 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|