C43H42N6O — CID 160928659
1-[5-ethyl-2-propyl-1-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]ethanol (PubChem CID 160928659) has the molecular formula C43H42N6O and a molecular weight of 658.85 g/mol. Its IUPAC name is 1-[5-ethyl-2-propyl-1-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]ethanol.
| Compound Name | 1-[5-ethyl-2-propyl-1-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]ethanol |
|---|---|
| PubChem CID | 160928659 |
| Molecular Formula | C43H42N6O |
| Molecular Weight | 658.85 g/mol |
| Exact Mass | 658.34 |
| IUPAC Name | 1-[5-ethyl-2-propyl-1-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]ethanol |
| SMILES | CCCc1nc(C(C)O)c(CC)n1Cc1ccc(-c2ccccc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C43H42N6O/c1-4-17-40-44-41(31(3)50)39(5-2)48(40)30-32-26-28-33(29-27-32)37-24-15-16-25-38(37)42-45-46-47-49(42)43(34-18-9-6-10-19-34,35-20-11-7-12-21-35)36-22-13-8-14-23-36/h6-16,18-29,31,50H,4-5,17,30H2,1-3H3 |
| InChIKey | SSYUVVMFDOWHCB-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.85 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|