C42H38N8 — CID 19002213
2-ethyl-6-propyl-1-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrazolo[1,5-b][1,2,4]triazole (PubChem CID 19002213) has the molecular formula C42H38N8 and a molecular weight of 654.82 g/mol. Its IUPAC name is 2-ethyl-6-propyl-1-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrazolo[1,5-b][1,2,4]triazole.
| Compound Name | 2-ethyl-6-propyl-1-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrazolo[1,5-b][1,2,4]triazole |
|---|---|
| PubChem CID | 19002213 |
| Molecular Formula | C42H38N8 |
| Molecular Weight | 654.82 g/mol |
| Exact Mass | 654.32 |
| IUPAC Name | 2-ethyl-6-propyl-1-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrazolo[1,5-b][1,2,4]triazole |
| SMILES | CCCc1cc2n(Cc3ccc(-c4ccccc4-c4nnnn4C(c4ccccc4)(c4ccccc4)c4ccccc4)cc3)c(CC)nn2n1 |
| InChI | InChI=1S/C42H38N8/c1-3-16-36-29-40-48(39(4-2)45-50(40)44-36)30-31-25-27-32(28-26-31)37-23-14-15-24-38(37)41-43-46-47-49(41)42(33-17-8-5-9-18-33,34-19-10-6-11-20-34)35-21-12-7-13-22-35/h5-15,17-29H,3-4,16,30H2,1-2H3 |
| InChIKey | XJWCXVSBHUNUDA-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 78.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.82 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|