C44H37N7O — CID 19106917
2-propyl-5-pyrrol-1-yl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carbaldehyde (PubChem CID 19106917) has the molecular formula C44H37N7O and a molecular weight of 679.83 g/mol. Its IUPAC name is 2-propyl-5-pyrrol-1-yl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carbaldehyde.
| Compound Name | 2-propyl-5-pyrrol-1-yl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carbaldehyde |
|---|---|
| PubChem CID | 19106917 |
| Molecular Formula | C44H37N7O |
| Molecular Weight | 679.83 g/mol |
| Exact Mass | 679.31 |
| IUPAC Name | 2-propyl-5-pyrrol-1-yl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carbaldehyde |
| SMILES | CCCc1nc(-n2cccc2)c(C=O)n1Cc1ccc(-c2ccccc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C44H37N7O/c1-2-16-41-45-43(49-29-14-15-30-49)40(32-52)50(41)31-33-25-27-34(28-26-33)38-23-12-13-24-39(38)42-46-47-48-51(42)44(35-17-6-3-7-18-35,36-19-8-4-9-20-36)37-21-10-5-11-22-37/h3-15,17-30,32H,2,16,31H2,1H3 |
| InChIKey | IRCFQVSNYYKTPC-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.83 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|