C43H36ClN6O2- — CID 19094431
(E)-3-[2-butyl-5-chloro-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]prop-2-enoate (PubChem CID 19094431) has the molecular formula C43H36ClN6O2- and a molecular weight of 704.25 g/mol. Its IUPAC name is (E)-3-[2-butyl-5-chloro-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]prop-2-enoate.
| Compound Name | (E)-3-[2-butyl-5-chloro-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 19094431 |
| Molecular Formula | C43H36ClN6O2- |
| Molecular Weight | 704.25 g/mol |
| Exact Mass | 703.26 |
| IUPAC Name | (E)-3-[2-butyl-5-chloro-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]prop-2-enoate |
| SMILES | CCCCc1nc(Cl)c(/C=C/C(=O)[O-])n1Cc1ccc(-c2ccccc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C43H37ClN6O2/c1-2-3-23-39-45-41(44)38(28-29-40(51)52)49(39)30-31-24-26-32(27-25-31)36-21-13-14-22-37(36)42-46-47-48-50(42)43(33-15-7-4-8-16-33,34-17-9-5-10-18-34)35-19-11-6-12-20-35/h4-22,24-29H,2-3,23,30H2,1H3,(H,51,52)/p-1/b29-28+ |
| InChIKey | GCJMVUHRODSVQU-ZQHSETAFSA-M |
| XLogP | 7.85 |
| TPSA | 101.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.25 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|