C49H43ClN6O3 — CID 54171726
2-[[2-butyl-5-chloro-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-methoxymethyl]benzoic acid (PubChem CID 54171726) has the molecular formula C49H43ClN6O3 and a molecular weight of 799.38 g/mol. Its IUPAC name is 2-[[2-butyl-5-chloro-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-methoxymethyl]benzoic acid.
| Compound Name | 2-[[2-butyl-5-chloro-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-methoxymethyl]benzoic acid |
|---|---|
| PubChem CID | 54171726 |
| Molecular Formula | C49H43ClN6O3 |
| Molecular Weight | 799.38 g/mol |
| Exact Mass | 798.31 |
| IUPAC Name | 2-[[2-butyl-5-chloro-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-methoxymethyl]benzoic acid |
| SMILES | CCCCc1nc(Cl)c(C(OC)c2ccccc2C(=O)O)n1Cc1ccc(-c2ccccc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C49H43ClN6O3/c1-3-4-28-43-51-46(50)44(45(59-2)40-25-15-17-27-42(40)48(57)58)55(43)33-34-29-31-35(32-30-34)39-24-14-16-26-41(39)47-52-53-54-56(47)49(36-18-8-5-9-19-36,37-20-10-6-11-21-37)38-22-12-7-13-23-38/h5-27,29-32,45H,3-4,28,33H2,1-2H3,(H,57,58) |
| InChIKey | OVMSMPIRSWIIGR-UHFFFAOYSA-N |
| XLogP | 10.52 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.38 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|