C46H43ClN6O5 — CID 16639207
1-ethoxycarbonyloxyethyl 2-butyl-5-chloro-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate (PubChem CID 16639207) has the molecular formula C46H43ClN6O5 and a molecular weight of 795.34 g/mol. Its IUPAC name is 1-ethoxycarbonyloxyethyl 2-butyl-5-chloro-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate.
| Compound Name | 1-ethoxycarbonyloxyethyl 2-butyl-5-chloro-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 16639207 |
| Molecular Formula | C46H43ClN6O5 |
| Molecular Weight | 795.34 g/mol |
| Exact Mass | 794.30 |
| IUPAC Name | 1-ethoxycarbonyloxyethyl 2-butyl-5-chloro-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
| SMILES | CCCCc1nc(Cl)c(C(=O)OC(C)OC(=O)OCC)n1Cc1ccc(-c2ccccc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C46H43ClN6O5/c1-4-6-26-40-48-42(47)41(44(54)57-32(3)58-45(55)56-5-2)52(40)31-33-27-29-34(30-28-33)38-24-16-17-25-39(38)43-49-50-51-53(43)46(35-18-10-7-11-19-35,36-20-12-8-13-21-36)37-22-14-9-15-23-37/h7-25,27-30,32H,4-6,26,31H2,1-3H3 |
| InChIKey | IRVBTVNAIHGYDL-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 123.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.34 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|