C49H49ClN6O2 — CID 67878385
ethyl (2E)-2-[[2-butyl-5-chloro-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methylidene]-4-methylpentanoate (PubChem CID 67878385) has the molecular formula C49H49ClN6O2 and a molecular weight of 789.42 g/mol. Its IUPAC name is ethyl (2E)-2-[[2-butyl-5-chloro-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methylidene]-4-methylpentanoate.
| Compound Name | ethyl (2E)-2-[[2-butyl-5-chloro-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methylidene]-4-methylpentanoate |
|---|---|
| PubChem CID | 67878385 |
| Molecular Formula | C49H49ClN6O2 |
| Molecular Weight | 789.42 g/mol |
| Exact Mass | 788.36 |
| IUPAC Name | ethyl (2E)-2-[[2-butyl-5-chloro-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methylidene]-4-methylpentanoate |
| SMILES | CCCCc1nc(Cl)c(/C=C(\CC(C)C)C(=O)OCC)n1Cc1ccc(-c2ccccc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C49H49ClN6O2/c1-5-7-27-45-51-46(50)44(33-38(32-35(3)4)48(57)58-6-2)55(45)34-36-28-30-37(31-29-36)42-25-17-18-26-43(42)47-52-53-54-56(47)49(39-19-11-8-12-20-39,40-21-13-9-14-22-40)41-23-15-10-16-24-41/h8-26,28-31,33,35H,5-7,27,32,34H2,1-4H3/b38-33+ |
| InChIKey | OAZKPEBQIGJHFI-NNIBMBRCSA-N |
| XLogP | 11.08 |
| TPSA | 87.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.42 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|