C51H51ClN6O2 — CID 67878760
methyl 3-[2-butyl-5-chloro-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-2-(cyclohexylmethyl)prop-2-enoate (PubChem CID 67878760) has the molecular formula C51H51ClN6O2 and a molecular weight of 815.46 g/mol. Its IUPAC name is methyl 3-[2-butyl-5-chloro-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-2-(cyclohexylmethyl)prop-2-enoate.
| Compound Name | methyl 3-[2-butyl-5-chloro-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-2-(cyclohexylmethyl)prop-2-enoate |
|---|---|
| PubChem CID | 67878760 |
| Molecular Formula | C51H51ClN6O2 |
| Molecular Weight | 815.46 g/mol |
| Exact Mass | 814.38 |
| IUPAC Name | methyl 3-[2-butyl-5-chloro-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-2-(cyclohexylmethyl)prop-2-enoate |
| SMILES | CCCCc1nc(Cl)c(C=C(CC2CCCCC2)C(=O)OC)n1Cc1ccc(-c2ccccc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C51H51ClN6O2/c1-3-4-29-47-53-48(52)46(35-40(50(59)60-2)34-37-19-9-5-10-20-37)57(47)36-38-30-32-39(33-31-38)44-27-17-18-28-45(44)49-54-55-56-58(49)51(41-21-11-6-12-22-41,42-23-13-7-14-24-42)43-25-15-8-16-26-43/h6-8,11-18,21-28,30-33,35,37H,3-5,9-10,19-20,29,34,36H2,1-2H3 |
| InChIKey | AGSCKZQYPQWUGX-UHFFFAOYSA-N |
| XLogP | 11.61 |
| TPSA | 87.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.46 |
| LogP ≤ 5 | 11.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|