C56H60N8O — CID 57168305
1-[2-butyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]benzimidazol-5-yl]-3-cyclohexyl-1-pentylurea (PubChem CID 57168305) has the molecular formula C56H60N8O and a molecular weight of 861.15 g/mol. Its IUPAC name is 1-[2-butyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]benzimidazol-5-yl]-3-cyclohexyl-1-pentylurea.
| Compound Name | 1-[2-butyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]benzimidazol-5-yl]-3-cyclohexyl-1-pentylurea |
|---|---|
| PubChem CID | 57168305 |
| Molecular Formula | C56H60N8O |
| Molecular Weight | 861.15 g/mol |
| Exact Mass | 860.49 |
| IUPAC Name | 1-[2-butyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]benzimidazol-5-yl]-3-cyclohexyl-1-pentylurea |
| SMILES | CCCCCN(C(=O)NC1CCCCC1)c1ccc2nc(CCCC)n(Cc3ccc(-c4ccccc4-c4nnnn4C(c4ccccc4)(c4ccccc4)c4ccccc4)cc3)c2c1 |
| InChI | InChI=1S/C56H60N8O/c1-3-5-21-39-62(55(65)57-47-28-17-10-18-29-47)48-37-38-51-52(40-48)63(53(58-51)32-6-4-2)41-42-33-35-43(36-34-42)49-30-19-20-31-50(49)54-59-60-61-64(54)56(44-22-11-7-12-23-44,45-24-13-8-14-25-45)46-26-15-9-16-27-46/h7-9,11-16,19-20,22-27,30-31,33-38,40,47H,3-6,10,17-18,21,28-29,32,39,41H2,1-2H3,(H,57,65) |
| InChIKey | AMNXXTCMGUBIDX-UHFFFAOYSA-N |
| XLogP | 12.63 |
| TPSA | 93.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.15 |
| LogP ≤ 5 | 12.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|