C47H40N6O2 — CID 15233930
6-acetyl-2-butyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]quinazolin-4-one (PubChem CID 15233930) has the molecular formula C47H40N6O2 and a molecular weight of 720.88 g/mol. Its IUPAC name is 6-acetyl-2-butyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]quinazolin-4-one.
| Compound Name | 6-acetyl-2-butyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 15233930 |
| Molecular Formula | C47H40N6O2 |
| Molecular Weight | 720.88 g/mol |
| Exact Mass | 720.32 |
| IUPAC Name | 6-acetyl-2-butyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]quinazolin-4-one |
| SMILES | CCCCc1nc2ccc(C(C)=O)cc2c(=O)n1Cc1ccc(-c2ccccc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C47H40N6O2/c1-3-4-24-44-48-43-30-29-36(33(2)54)31-42(43)46(55)52(44)32-34-25-27-35(28-26-34)40-22-14-15-23-41(40)45-49-50-51-53(45)47(37-16-8-5-9-17-37,38-18-10-6-11-19-38)39-20-12-7-13-21-39/h5-23,25-31H,3-4,24,32H2,1-2H3 |
| InChIKey | VIXXMGIPTJIWDK-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 95.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.88 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|