C45H37N7O3 — CID 131718095
2-butyl-6-nitro-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]quinazolin-4-one (PubChem CID 131718095) has the molecular formula C45H37N7O3 and a molecular weight of 723.84 g/mol. Its IUPAC name is 2-butyl-6-nitro-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]quinazolin-4-one.
| Compound Name | 2-butyl-6-nitro-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 131718095 |
| Molecular Formula | C45H37N7O3 |
| Molecular Weight | 723.84 g/mol |
| Exact Mass | 723.30 |
| IUPAC Name | 2-butyl-6-nitro-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]quinazolin-4-one |
| SMILES | CCCCc1nc2ccc([N+](=O)[O-])cc2c(=O)n1Cc1ccc(-c2ccccc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C45H37N7O3/c1-2-3-23-42-46-41-29-28-37(52(54)55)30-40(41)44(53)50(42)31-32-24-26-33(27-25-32)38-21-13-14-22-39(38)43-47-48-49-51(43)45(34-15-7-4-8-16-34,35-17-9-5-10-18-35)36-19-11-6-12-20-36/h4-22,24-30H,2-3,23,31H2,1H3 |
| InChIKey | ZPQCVMRTSGFQNX-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 121.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.84 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|