C47H42N6O4S — CID 19099543
[2-butyl-4-oxo-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]quinazolin-6-yl]methyl methanesulfonate (PubChem CID 19099543) has the molecular formula C47H42N6O4S and a molecular weight of 786.96 g/mol. Its IUPAC name is [2-butyl-4-oxo-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]quinazolin-6-yl]methyl methanesulfonate.
| Compound Name | [2-butyl-4-oxo-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]quinazolin-6-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 19099543 |
| Molecular Formula | C47H42N6O4S |
| Molecular Weight | 786.96 g/mol |
| Exact Mass | 786.30 |
| IUPAC Name | [2-butyl-4-oxo-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]quinazolin-6-yl]methyl methanesulfonate |
| SMILES | CCCCc1nc2ccc(COS(C)(=O)=O)cc2c(=O)n1Cc1ccc(-c2ccccc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C47H42N6O4S/c1-3-4-24-44-48-43-30-27-35(33-57-58(2,55)56)31-42(43)46(54)52(44)32-34-25-28-36(29-26-34)40-22-14-15-23-41(40)45-49-50-51-53(45)47(37-16-8-5-9-17-37,38-18-10-6-11-19-38)39-20-12-7-13-21-39/h5-23,25-31H,3-4,24,32-33H2,1-2H3 |
| InChIKey | OMXDYRSSHFRHBZ-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 121.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.96 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|