C46H43N7O — CID 19036161
2-butyl-5-(2,2-dimethylpropanoyl)-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carbonitrile (PubChem CID 19036161) has the molecular formula C46H43N7O and a molecular weight of 709.90 g/mol. Its IUPAC name is 2-butyl-5-(2,2-dimethylpropanoyl)-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carbonitrile.
| Compound Name | 2-butyl-5-(2,2-dimethylpropanoyl)-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carbonitrile |
|---|---|
| PubChem CID | 19036161 |
| Molecular Formula | C46H43N7O |
| Molecular Weight | 709.90 g/mol |
| Exact Mass | 709.35 |
| IUPAC Name | 2-butyl-5-(2,2-dimethylpropanoyl)-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carbonitrile |
| SMILES | CCCCc1nc(C(=O)C(C)(C)C)c(C#N)n1Cc1ccc(-c2ccccc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C46H43N7O/c1-5-6-26-41-48-42(43(54)45(2,3)4)40(31-47)52(41)32-33-27-29-34(30-28-33)38-24-16-17-25-39(38)44-49-50-51-53(44)46(35-18-10-7-11-19-35,36-20-12-8-13-21-36)37-22-14-9-15-23-37/h7-25,27-30H,5-6,26,32H2,1-4H3 |
| InChIKey | NJRPKUKJXROYNH-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 102.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.90 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|