C49H44N6O — CID 10509161
3-benzyl-6-butyl-2-methyl-5-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrimidin-4-one (PubChem CID 10509161) has the molecular formula C49H44N6O and a molecular weight of 732.93 g/mol. Its IUPAC name is 3-benzyl-6-butyl-2-methyl-5-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrimidin-4-one.
| Compound Name | 3-benzyl-6-butyl-2-methyl-5-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 10509161 |
| Molecular Formula | C49H44N6O |
| Molecular Weight | 732.93 g/mol |
| Exact Mass | 732.36 |
| IUPAC Name | 3-benzyl-6-butyl-2-methyl-5-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrimidin-4-one |
| SMILES | CCCCc1nc(C)n(Cc2ccccc2)c(=O)c1Cc1ccc(-c2ccccc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C49H44N6O/c1-3-4-29-46-45(48(56)54(36(2)50-46)35-38-19-9-5-10-20-38)34-37-30-32-39(33-31-37)43-27-17-18-28-44(43)47-51-52-53-55(47)49(40-21-11-6-12-22-40,41-23-13-7-14-24-41)42-25-15-8-16-26-42/h5-28,30-33H,3-4,29,34-35H2,1-2H3 |
| InChIKey | DYAOJIFXCJOZDY-UHFFFAOYSA-N |
| XLogP | 9.69 |
| TPSA | 78.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.93 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|