C49H44N6O3S — CID 10533348
methyl 2-[[4-butyl-2-methyl-6-oxo-5-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrimidin-1-yl]methyl]thiophene-3-carboxylate (PubChem CID 10533348) has the molecular formula C49H44N6O3S and a molecular weight of 797.00 g/mol. Its IUPAC name is methyl 2-[[4-butyl-2-methyl-6-oxo-5-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrimidin-1-yl]methyl]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[4-butyl-2-methyl-6-oxo-5-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrimidin-1-yl]methyl]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 10533348 |
| Molecular Formula | C49H44N6O3S |
| Molecular Weight | 797.00 g/mol |
| Exact Mass | 796.32 |
| IUPAC Name | methyl 2-[[4-butyl-2-methyl-6-oxo-5-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrimidin-1-yl]methyl]thiophene-3-carboxylate |
| SMILES | CCCCc1nc(C)n(Cc2sccc2C(=O)OC)c(=O)c1Cc1ccc(-c2ccccc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C49H44N6O3S/c1-4-5-25-44-43(47(56)54(34(2)50-44)33-45-42(30-31-59-45)48(57)58-3)32-35-26-28-36(29-27-35)40-23-15-16-24-41(40)46-51-52-53-55(46)49(37-17-9-6-10-18-37,38-19-11-7-12-20-38)39-21-13-8-14-22-39/h6-24,26-31H,4-5,25,32-33H2,1-3H3 |
| InChIKey | FCYCTTLPHDTQTI-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 104.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.00 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|