C44H41N5O — CID 10009524
2-butyl-4,5-dimethyl-1-oxido-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyridin-1-ium (PubChem CID 10009524) has the molecular formula C44H41N5O and a molecular weight of 655.85 g/mol. Its IUPAC name is 2-butyl-4,5-dimethyl-1-oxido-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyridin-1-ium.
| Compound Name | 2-butyl-4,5-dimethyl-1-oxido-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyridin-1-ium |
|---|---|
| PubChem CID | 10009524 |
| Molecular Formula | C44H41N5O |
| Molecular Weight | 655.85 g/mol |
| Exact Mass | 655.33 |
| IUPAC Name | 2-butyl-4,5-dimethyl-1-oxido-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyridin-1-ium |
| SMILES | CCCCc1c(Cc2ccc(-c3ccccc3-c3nnnn3C(c3ccccc3)(c3ccccc3)c3ccccc3)cc2)c(C)c(C)c[n+]1[O-] |
| InChI | InChI=1S/C44H41N5O/c1-4-5-25-42-41(33(3)32(2)31-48(42)50)30-34-26-28-35(29-27-34)39-23-15-16-24-40(39)43-45-46-47-49(43)44(36-17-9-6-10-18-36,37-19-11-7-12-20-37)38-21-13-8-14-22-38/h6-24,26-29,31H,4-5,25,30H2,1-3H3 |
| InChIKey | HEHCRDQOXHFEFE-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.85 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|