C43H38N6S — CID 139628346
2-butyl-4-methyl-6-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]-1H-thieno[3,4-d]imidazole (PubChem CID 139628346) has the molecular formula C43H38N6S and a molecular weight of 670.89 g/mol. Its IUPAC name is 2-butyl-4-methyl-6-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]-1H-thieno[3,4-d]imidazole.
| Compound Name | 2-butyl-4-methyl-6-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]-1H-thieno[3,4-d]imidazole |
|---|---|
| PubChem CID | 139628346 |
| Molecular Formula | C43H38N6S |
| Molecular Weight | 670.89 g/mol |
| Exact Mass | 670.29 |
| IUPAC Name | 2-butyl-4-methyl-6-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]-1H-thieno[3,4-d]imidazole |
| SMILES | CCCCc1nc2c(C)sc(Cc3ccc(-c4ccccc4-c4nnnn4C(c4ccccc4)(c4ccccc4)c4ccccc4)cc3)c2[nH]1 |
| InChI | InChI=1S/C43H38N6S/c1-3-4-24-39-44-40-30(2)50-38(41(40)45-39)29-31-25-27-32(28-26-31)36-22-14-15-23-37(36)42-46-47-48-49(42)43(33-16-8-5-9-17-33,34-18-10-6-11-19-34)35-20-12-7-13-21-35/h5-23,25-28H,3-4,24,29H2,1-2H3,(H,44,45) |
| InChIKey | UABVWKUVLUFZIM-UHFFFAOYSA-N |
| XLogP | 10.03 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.89 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|