C46H43N7O2 — CID 67839633
5-butyl-3-propan-2-yl-6-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]-1,3-dihydroimidazo[1,2-a]pyrimidine-2,7-dione (PubChem CID 67839633) has the molecular formula C46H43N7O2 and a molecular weight of 725.90 g/mol. Its IUPAC name is 5-butyl-3-propan-2-yl-6-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]-1,3-dihydroimidazo[1,2-a]pyrimidine-2,7-dione.
| Compound Name | 5-butyl-3-propan-2-yl-6-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]-1,3-dihydroimidazo[1,2-a]pyrimidine-2,7-dione |
|---|---|
| PubChem CID | 67839633 |
| Molecular Formula | C46H43N7O2 |
| Molecular Weight | 725.90 g/mol |
| Exact Mass | 725.35 |
| IUPAC Name | 5-butyl-3-propan-2-yl-6-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]-1,3-dihydroimidazo[1,2-a]pyrimidine-2,7-dione |
| SMILES | CCCCc1c(Cc2ccc(-c3ccccc3-c3nnnn3C(c3ccccc3)(c3ccccc3)c3ccccc3)cc2)c(=O)nc2n1C(C(C)C)C(=O)N2 |
| InChI | InChI=1S/C46H43N7O2/c1-4-5-25-40-39(43(54)47-45-48-44(55)41(31(2)3)52(40)45)30-32-26-28-33(29-27-32)37-23-15-16-24-38(37)42-49-50-51-53(42)46(34-17-9-6-10-18-34,35-19-11-7-12-20-35)36-21-13-8-14-22-36/h6-24,26-29,31,41H,4-5,25,30H2,1-3H3,(H,47,48,54,55) |
| InChIKey | UPZCOXLUYZFZBA-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 107.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.90 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|