C51H48N7O2+ — CID 21479230
1-[2-butyl-1-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]benzimidazol-1-ium-1-yl]-4,4-dimethylpiperidine-2,6-dione (PubChem CID 21479230) has the molecular formula C51H48N7O2+ and a molecular weight of 790.99 g/mol. Its IUPAC name is 1-[2-butyl-1-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]benzimidazol-1-ium-1-yl]-4,4-dimethylpiperidine-2,6-dione.
| Compound Name | 1-[2-butyl-1-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]benzimidazol-1-ium-1-yl]-4,4-dimethylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 21479230 |
| Molecular Formula | C51H48N7O2+ |
| Molecular Weight | 790.99 g/mol |
| Exact Mass | 790.39 |
| IUPAC Name | 1-[2-butyl-1-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]benzimidazol-1-ium-1-yl]-4,4-dimethylpiperidine-2,6-dione |
| SMILES | CCCCC1=Nc2ccccc2[N+]1(Cc1ccc(-c2ccccc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1)N1C(=O)CC(C)(C)CC1=O |
| InChI | InChI=1S/C51H48N7O2/c1-4-5-29-46-52-44-27-17-18-28-45(44)58(46,56-47(59)34-50(2,3)35-48(56)60)36-37-30-32-38(33-31-37)42-25-15-16-26-43(42)49-53-54-55-57(49)51(39-19-9-6-10-20-39,40-21-11-7-12-22-40)41-23-13-8-14-24-41/h6-28,30-33H,4-5,29,34-36H2,1-3H3/q+1 |
| InChIKey | ZIEOKYBDYKINDU-UHFFFAOYSA-N |
| XLogP | 10.68 |
| TPSA | 93.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.99 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|