C40H32Br2N6O2 — CID 139613705
4,5-dibromo-6-propoxy-2-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyridazin-3-one (PubChem CID 139613705) has the molecular formula C40H32Br2N6O2 and a molecular weight of 788.54 g/mol. Its IUPAC name is 4,5-dibromo-6-propoxy-2-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyridazin-3-one.
| Compound Name | 4,5-dibromo-6-propoxy-2-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyridazin-3-one |
|---|---|
| PubChem CID | 139613705 |
| Molecular Formula | C40H32Br2N6O2 |
| Molecular Weight | 788.54 g/mol |
| Exact Mass | 786.10 |
| IUPAC Name | 4,5-dibromo-6-propoxy-2-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyridazin-3-one |
| SMILES | CCCOc1nn(Cc2ccc(-c3ccccc3-c3nnnn3C(c3ccccc3)(c3ccccc3)c3ccccc3)cc2)c(=O)c(Br)c1Br |
| InChI | InChI=1S/C40H32Br2N6O2/c1-2-26-50-38-35(41)36(42)39(49)47(44-38)27-28-22-24-29(25-23-28)33-20-12-13-21-34(33)37-43-45-46-48(37)40(30-14-6-3-7-15-30,31-16-8-4-9-17-31)32-18-10-5-11-19-32/h3-25H,2,26-27H2,1H3 |
| InChIKey | QFPQSTSVJNYRMG-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 87.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.54 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|