C47H43ClN6O6 — CID 139613707
diethyl 2-[5-chloro-6-oxo-3-propoxy-1-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyridazin-4-yl]propanedioate (PubChem CID 139613707) has the molecular formula C47H43ClN6O6 and a molecular weight of 823.35 g/mol. Its IUPAC name is diethyl 2-[5-chloro-6-oxo-3-propoxy-1-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyridazin-4-yl]propanedioate.
| Compound Name | diethyl 2-[5-chloro-6-oxo-3-propoxy-1-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyridazin-4-yl]propanedioate |
|---|---|
| PubChem CID | 139613707 |
| Molecular Formula | C47H43ClN6O6 |
| Molecular Weight | 823.35 g/mol |
| Exact Mass | 822.29 |
| IUPAC Name | diethyl 2-[5-chloro-6-oxo-3-propoxy-1-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyridazin-4-yl]propanedioate |
| SMILES | CCCOc1nn(Cc2ccc(-c3ccccc3-c3nnnn3C(c3ccccc3)(c3ccccc3)c3ccccc3)cc2)c(=O)c(Cl)c1C(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C47H43ClN6O6/c1-4-30-60-43-39(40(45(56)58-5-2)46(57)59-6-3)41(48)44(55)53(50-43)31-32-26-28-33(29-27-32)37-24-16-17-25-38(37)42-49-51-52-54(42)47(34-18-10-7-11-19-34,35-20-12-8-13-21-35)36-22-14-9-15-23-36/h7-29,40H,4-6,30-31H2,1-3H3 |
| InChIKey | ZRHOVMFGVJMHGC-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 140.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.35 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|