C46H47N7O2 — CID 139665723
ethyl 1,5-diethyl-3-[propyl-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]amino]pyrazole-4-carboxylate (PubChem CID 139665723) has the molecular formula C46H47N7O2 and a molecular weight of 729.93 g/mol. Its IUPAC name is ethyl 1,5-diethyl-3-[propyl-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]amino]pyrazole-4-carboxylate.
| Compound Name | ethyl 1,5-diethyl-3-[propyl-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]amino]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 139665723 |
| Molecular Formula | C46H47N7O2 |
| Molecular Weight | 729.93 g/mol |
| Exact Mass | 729.38 |
| IUPAC Name | ethyl 1,5-diethyl-3-[propyl-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]amino]pyrazole-4-carboxylate |
| SMILES | CCCN(Cc1ccc(-c2ccccc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1)c1nn(CC)c(CC)c1C(=O)OCC |
| InChI | InChI=1S/C46H47N7O2/c1-5-32-51(44-42(45(54)55-8-4)41(6-2)52(7-3)48-44)33-34-28-30-35(31-29-34)39-26-18-19-27-40(39)43-47-49-50-53(43)46(36-20-12-9-13-21-36,37-22-14-10-15-23-37)38-24-16-11-17-25-38/h9-31H,5-8,32-33H2,1-4H3 |
| InChIKey | MIFNZPQOSRYWEN-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 90.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.93 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|