C43H42N8O2 — CID 19017743
ethyl 5-[butyl-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]amino]-3-methyltriazole-4-carboxylate (PubChem CID 19017743) has the molecular formula C43H42N8O2 and a molecular weight of 702.86 g/mol. Its IUPAC name is ethyl 5-[butyl-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]amino]-3-methyltriazole-4-carboxylate.
| Compound Name | ethyl 5-[butyl-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]amino]-3-methyltriazole-4-carboxylate |
|---|---|
| PubChem CID | 19017743 |
| Molecular Formula | C43H42N8O2 |
| Molecular Weight | 702.86 g/mol |
| Exact Mass | 702.34 |
| IUPAC Name | ethyl 5-[butyl-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]amino]-3-methyltriazole-4-carboxylate |
| SMILES | CCCCN(Cc1ccc(-c2ccccc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1)c1nnn(C)c1C(=O)OCC |
| InChI | InChI=1S/C43H42N8O2/c1-4-6-30-50(41-39(42(52)53-5-2)49(3)47-45-41)31-32-26-28-33(29-27-32)37-24-16-17-25-38(37)40-44-46-48-51(40)43(34-18-10-7-11-19-34,35-20-12-8-13-21-35)36-22-14-9-15-23-36/h7-29H,4-6,30-31H2,1-3H3 |
| InChIKey | ACOSKZRYMZAYCE-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 103.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.86 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|