C45H41N7O4 — CID 19791753
(2-methoxy-2-oxoethyl) 4-[butyl-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]amino]pyrimidine-5-carboxylate (PubChem CID 19791753) has the molecular formula C45H41N7O4 and a molecular weight of 743.87 g/mol. Its IUPAC name is (2-methoxy-2-oxoethyl) 4-[butyl-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]amino]pyrimidine-5-carboxylate.
| Compound Name | (2-methoxy-2-oxoethyl) 4-[butyl-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]amino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 19791753 |
| Molecular Formula | C45H41N7O4 |
| Molecular Weight | 743.87 g/mol |
| Exact Mass | 743.32 |
| IUPAC Name | (2-methoxy-2-oxoethyl) 4-[butyl-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]amino]pyrimidine-5-carboxylate |
| SMILES | CCCCN(Cc1ccc(-c2ccccc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1)c1ncncc1C(=O)OCC(=O)OC |
| InChI | InChI=1S/C45H41N7O4/c1-3-4-28-51(42-40(29-46-32-47-42)44(54)56-31-41(53)55-2)30-33-24-26-34(27-25-33)38-22-14-15-23-39(38)43-48-49-50-52(43)45(35-16-8-5-9-17-35,36-18-10-6-11-19-36)37-20-12-7-13-21-37/h5-27,29,32H,3-4,28,30-31H2,1-2H3 |
| InChIKey | QTOHEICZUONNHL-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 125.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.87 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|