C48H43N7O2 — CID 139665714
ethyl 1-(3-phenylpropyl)-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methylamino]pyrazole-4-carboxylate (PubChem CID 139665714) has the molecular formula C48H43N7O2 and a molecular weight of 749.92 g/mol. Its IUPAC name is ethyl 1-(3-phenylpropyl)-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methylamino]pyrazole-4-carboxylate.
| Compound Name | ethyl 1-(3-phenylpropyl)-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methylamino]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 139665714 |
| Molecular Formula | C48H43N7O2 |
| Molecular Weight | 749.92 g/mol |
| Exact Mass | 749.35 |
| IUPAC Name | ethyl 1-(3-phenylpropyl)-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methylamino]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn(CCCc2ccccc2)nc1NCc1ccc(-c2ccccc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C48H43N7O2/c1-2-57-47(56)44-35-54(33-17-20-36-18-7-3-8-19-36)51-45(44)49-34-37-29-31-38(32-30-37)42-27-15-16-28-43(42)46-50-52-53-55(46)48(39-21-9-4-10-22-39,40-23-11-5-12-24-40)41-25-13-6-14-26-41/h3-16,18-19,21-32,35H,2,17,20,33-34H2,1H3,(H,49,51) |
| InChIKey | LMPNQHFPKXGENG-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 99.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.92 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|