C43H37N5O3 — CID 150873033
ethyl 5-methoxy-2,6-dimethyl-4-[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]pyridine-3-carboxylate (PubChem CID 150873033) has the molecular formula C43H37N5O3 and a molecular weight of 671.80 g/mol. Its IUPAC name is ethyl 5-methoxy-2,6-dimethyl-4-[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]pyridine-3-carboxylate.
| Compound Name | ethyl 5-methoxy-2,6-dimethyl-4-[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 150873033 |
| Molecular Formula | C43H37N5O3 |
| Molecular Weight | 671.80 g/mol |
| Exact Mass | 671.29 |
| IUPAC Name | ethyl 5-methoxy-2,6-dimethyl-4-[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)nc(C)c(OC)c1-c1ccc(-c2ccccc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C43H37N5O3/c1-5-51-42(49)38-29(2)44-30(3)40(50-4)39(38)32-27-25-31(26-28-32)36-23-15-16-24-37(36)41-45-46-47-48(41)43(33-17-9-6-10-18-33,34-19-11-7-12-20-34)35-21-13-8-14-22-35/h6-28H,5H2,1-4H3 |
| InChIKey | KULAXJVYSLLDGK-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 92.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.80 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|