C40H40N6O — CID 77171600
N-(1-aminopropan-2-yl)-N-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]butanamide (PubChem CID 77171600) has the molecular formula C40H40N6O and a molecular weight of 620.80 g/mol. Its IUPAC name is N-(1-aminopropan-2-yl)-N-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]butanamide.
| Compound Name | N-(1-aminopropan-2-yl)-N-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 77171600 |
| Molecular Formula | C40H40N6O |
| Molecular Weight | 620.80 g/mol |
| Exact Mass | 620.33 |
| IUPAC Name | N-(1-aminopropan-2-yl)-N-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]butanamide |
| SMILES | CCCC(=O)N(Cc1ccc(-c2ccccc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1)C(C)CN |
| InChI | InChI=1S/C40H40N6O/c1-3-15-38(47)45(30(2)28-41)29-31-24-26-32(27-25-31)36-22-13-14-23-37(36)39-42-43-44-46(39)40(33-16-7-4-8-17-33,34-18-9-5-10-19-34)35-20-11-6-12-21-35/h4-14,16-27,30H,3,15,28-29,41H2,1-2H3 |
| InChIKey | CKYJCLPVXQNIAZ-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.80 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|