C43H38ClN7O2 — CID 19792028
methyl 6-[butyl-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]amino]-2-chloropyrimidine-4-carboxylate (PubChem CID 19792028) has the molecular formula C43H38ClN7O2 and a molecular weight of 720.28 g/mol. Its IUPAC name is methyl 6-[butyl-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]amino]-2-chloropyrimidine-4-carboxylate.
| Compound Name | methyl 6-[butyl-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]amino]-2-chloropyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 19792028 |
| Molecular Formula | C43H38ClN7O2 |
| Molecular Weight | 720.28 g/mol |
| Exact Mass | 719.28 |
| IUPAC Name | methyl 6-[butyl-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]amino]-2-chloropyrimidine-4-carboxylate |
| SMILES | CCCCN(Cc1ccc(-c2ccccc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1)c1cc(C(=O)OC)nc(Cl)n1 |
| InChI | InChI=1S/C43H38ClN7O2/c1-3-4-28-50(39-29-38(41(52)53-2)45-42(44)46-39)30-31-24-26-32(27-25-31)36-22-14-15-23-37(36)40-47-48-49-51(40)43(33-16-8-5-9-17-33,34-18-10-6-11-19-34)35-20-12-7-13-21-35/h5-27,29H,3-4,28,30H2,1-2H3 |
| InChIKey | HYCKBDKRIHBUKF-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 98.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.28 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|