C46H40N6O3 — CID 23363081
methyl 2-[2-butyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]furan-3-carboxylate (PubChem CID 23363081) has the molecular formula C46H40N6O3 and a molecular weight of 724.87 g/mol. Its IUPAC name is methyl 2-[2-butyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]furan-3-carboxylate.
| Compound Name | methyl 2-[2-butyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]furan-3-carboxylate |
|---|---|
| PubChem CID | 23363081 |
| Molecular Formula | C46H40N6O3 |
| Molecular Weight | 724.87 g/mol |
| Exact Mass | 724.32 |
| IUPAC Name | methyl 2-[2-butyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]furan-3-carboxylate |
| SMILES | CCCCc1ncc(-c2occc2C(=O)OC)n1Cc1ccc(-c2ccccc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C46H40N6O3/c1-3-4-24-42-47-31-41(43-40(29-30-55-43)45(53)54-2)51(42)32-33-25-27-34(28-26-33)38-22-14-15-23-39(38)44-48-49-50-52(44)46(35-16-8-5-9-17-35,36-18-10-6-11-19-36)37-20-12-7-13-21-37/h5-23,25-31H,3-4,24,32H2,1-2H3 |
| InChIKey | VCBCHQORIKWUIS-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 100.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.87 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|