C39H31ClN8 — CID 19002208
7-chloro-2-ethyl-5-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrazolo[1,5-b][1,2,4]triazole (PubChem CID 19002208) has the molecular formula C39H31ClN8 and a molecular weight of 647.19 g/mol. Its IUPAC name is 7-chloro-2-ethyl-5-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrazolo[1,5-b][1,2,4]triazole.
| Compound Name | 7-chloro-2-ethyl-5-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrazolo[1,5-b][1,2,4]triazole |
|---|---|
| PubChem CID | 19002208 |
| Molecular Formula | C39H31ClN8 |
| Molecular Weight | 647.19 g/mol |
| Exact Mass | 646.24 |
| IUPAC Name | 7-chloro-2-ethyl-5-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrazolo[1,5-b][1,2,4]triazole |
| SMILES | CCc1nc2c(Cl)cn(Cc3ccc(-c4ccccc4-c4nnnn4C(c4ccccc4)(c4ccccc4)c4ccccc4)cc3)n2n1 |
| InChI | InChI=1S/C39H31ClN8/c1-2-36-41-38-35(40)27-46(48(38)43-36)26-28-22-24-29(25-23-28)33-20-12-13-21-34(33)37-42-44-45-47(37)39(30-14-6-3-7-15-30,31-16-8-4-9-17-31)32-18-10-5-11-19-32/h3-25,27H,2,26H2,1H3 |
| InChIKey | VOKQOEULDFLCKB-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 78.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.19 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|