C45H41N7O — CID 70226788
2-butyl-5-[3-methyl-2-oxo-1-[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]butyl]-1H-imidazole-4-carbonitrile (PubChem CID 70226788) has the molecular formula C45H41N7O and a molecular weight of 695.87 g/mol. Its IUPAC name is 2-butyl-5-[3-methyl-2-oxo-1-[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]butyl]-1H-imidazole-4-carbonitrile.
| Compound Name | 2-butyl-5-[3-methyl-2-oxo-1-[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]butyl]-1H-imidazole-4-carbonitrile |
|---|---|
| PubChem CID | 70226788 |
| Molecular Formula | C45H41N7O |
| Molecular Weight | 695.87 g/mol |
| Exact Mass | 695.34 |
| IUPAC Name | 2-butyl-5-[3-methyl-2-oxo-1-[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]butyl]-1H-imidazole-4-carbonitrile |
| SMILES | CCCCc1nc(C#N)c(C(C(=O)C(C)C)c2ccc(-c3ccccc3-c3nnnn3C(c3ccccc3)(c3ccccc3)c3ccccc3)cc2)[nH]1 |
| InChI | InChI=1S/C45H41N7O/c1-4-5-25-40-47-39(30-46)42(48-40)41(43(53)31(2)3)33-28-26-32(27-29-33)37-23-15-16-24-38(37)44-49-50-51-52(44)45(34-17-9-6-10-18-34,35-19-11-7-12-20-35)36-21-13-8-14-22-36/h6-24,26-29,31,41H,4-5,25H2,1-3H3,(H,47,48) |
| InChIKey | YGGSIPRVIPPOLX-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 113.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.87 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|