C46H42N8O — CID 67778792
2-[2-butyl-1-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-3,6-dimethyl-1-oxidopyrazin-1-ium (PubChem CID 67778792) has the molecular formula C46H42N8O and a molecular weight of 722.90 g/mol. Its IUPAC name is 2-[2-butyl-1-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-3,6-dimethyl-1-oxidopyrazin-1-ium.
| Compound Name | 2-[2-butyl-1-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-3,6-dimethyl-1-oxidopyrazin-1-ium |
|---|---|
| PubChem CID | 67778792 |
| Molecular Formula | C46H42N8O |
| Molecular Weight | 722.90 g/mol |
| Exact Mass | 722.35 |
| IUPAC Name | 2-[2-butyl-1-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-3,6-dimethyl-1-oxidopyrazin-1-ium |
| SMILES | CCCCc1nc(-c2c(C)ncc(C)[n+]2[O-])cn1Cc1ccc(-c2ccccc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C46H42N8O/c1-4-5-25-43-48-42(44-34(3)47-30-33(2)53(44)55)32-52(43)31-35-26-28-36(29-27-35)40-23-15-16-24-41(40)45-49-50-51-54(45)46(37-17-9-6-10-18-37,38-19-11-7-12-20-38)39-21-13-8-14-22-39/h6-24,26-30,32H,4-5,25,31H2,1-3H3 |
| InChIKey | DSTPRLNRMDKALI-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 101.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.90 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|