C48H43N7O3 — CID 10372993
methyl 2-[2-butyl-1-[[4-[4-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-6-methyl-1-oxidopyridin-1-ium-3-carboxylate (PubChem CID 10372993) has the molecular formula C48H43N7O3 and a molecular weight of 765.92 g/mol. Its IUPAC name is methyl 2-[2-butyl-1-[[4-[4-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-6-methyl-1-oxidopyridin-1-ium-3-carboxylate.
| Compound Name | methyl 2-[2-butyl-1-[[4-[4-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-6-methyl-1-oxidopyridin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 10372993 |
| Molecular Formula | C48H43N7O3 |
| Molecular Weight | 765.92 g/mol |
| Exact Mass | 765.34 |
| IUPAC Name | methyl 2-[2-butyl-1-[[4-[4-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-6-methyl-1-oxidopyridin-1-ium-3-carboxylate |
| SMILES | CCCCc1nc(-c2c(C(=O)OC)ccc(C)[n+]2[O-])cn1Cc1ccc(-c2ccc(-c3nnnn3C(c3ccccc3)(c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C48H43N7O3/c1-4-5-21-44-49-43(45-42(47(56)58-3)31-22-34(2)54(45)57)33-53(44)32-35-23-25-36(26-24-35)37-27-29-38(30-28-37)46-50-51-52-55(46)48(39-15-9-6-10-16-39,40-17-11-7-12-18-40)41-19-13-8-14-20-41/h6-20,22-31,33H,4-5,21,32H2,1-3H3 |
| InChIKey | ZIUVKZDSAYNBTK-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 114.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.92 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|