C44H38N8 — CID 10372378
2-[2-butyl-1-[[4-[4-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]pyrimidine (PubChem CID 10372378) has the molecular formula C44H38N8 and a molecular weight of 678.84 g/mol. Its IUPAC name is 2-[2-butyl-1-[[4-[4-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]pyrimidine.
| Compound Name | 2-[2-butyl-1-[[4-[4-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]pyrimidine |
|---|---|
| PubChem CID | 10372378 |
| Molecular Formula | C44H38N8 |
| Molecular Weight | 678.84 g/mol |
| Exact Mass | 678.32 |
| IUPAC Name | 2-[2-butyl-1-[[4-[4-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]pyrimidine |
| SMILES | CCCCc1nc(-c2ncccn2)cn1Cc1ccc(-c2ccc(-c3nnnn3C(c3ccccc3)(c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C44H38N8/c1-2-3-20-41-47-40(42-45-29-13-30-46-42)32-51(41)31-33-21-23-34(24-22-33)35-25-27-36(28-26-35)43-48-49-50-52(43)44(37-14-7-4-8-15-37,38-16-9-5-10-17-38)39-18-11-6-12-19-39/h4-19,21-30,32H,2-3,20,31H2,1H3 |
| InChIKey | ZAMIWMOZTOOODM-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.84 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|