C47H49N7O2 — CID 19932973
tert-butyl N-[2-[2-butyl-1-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]ethyl]carbamate (PubChem CID 19932973) has the molecular formula C47H49N7O2 and a molecular weight of 743.96 g/mol. Its IUPAC name is tert-butyl N-[2-[2-butyl-1-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-butyl-1-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 19932973 |
| Molecular Formula | C47H49N7O2 |
| Molecular Weight | 743.96 g/mol |
| Exact Mass | 743.39 |
| IUPAC Name | tert-butyl N-[2-[2-butyl-1-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]ethyl]carbamate |
| SMILES | CCCCc1nc(CCNC(=O)OC(C)(C)C)cn1Cc1ccc(-c2ccccc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C47H49N7O2/c1-5-6-26-43-49-40(31-32-48-45(55)56-46(2,3)4)34-53(43)33-35-27-29-36(30-28-35)41-24-16-17-25-42(41)44-50-51-52-54(44)47(37-18-10-7-11-19-37,38-20-12-8-13-21-38)39-22-14-9-15-23-39/h7-25,27-30,34H,5-6,26,31-33H2,1-4H3,(H,48,55) |
| InChIKey | RYZARUVEDLYZML-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 99.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.96 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|