C48H43N7O2 — CID 10485211
methyl 2-[2-butyl-1-[[4-[4-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-6-methylpyridine-4-carboxylate (PubChem CID 10485211) has the molecular formula C48H43N7O2 and a molecular weight of 749.92 g/mol. Its IUPAC name is methyl 2-[2-butyl-1-[[4-[4-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-6-methylpyridine-4-carboxylate.
| Compound Name | methyl 2-[2-butyl-1-[[4-[4-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-6-methylpyridine-4-carboxylate |
|---|---|
| PubChem CID | 10485211 |
| Molecular Formula | C48H43N7O2 |
| Molecular Weight | 749.92 g/mol |
| Exact Mass | 749.35 |
| IUPAC Name | methyl 2-[2-butyl-1-[[4-[4-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-6-methylpyridine-4-carboxylate |
| SMILES | CCCCc1nc(-c2cc(C(=O)OC)cc(C)n2)cn1Cc1ccc(-c2ccc(-c3nnnn3C(c3ccccc3)(c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C48H43N7O2/c1-4-5-21-45-50-44(43-31-39(47(56)57-3)30-34(2)49-43)33-54(45)32-35-22-24-36(25-23-35)37-26-28-38(29-27-37)46-51-52-53-55(46)48(40-15-9-6-10-16-40,41-17-11-7-12-18-41)42-19-13-8-14-20-42/h6-20,22-31,33H,4-5,21,32H2,1-3H3 |
| InChIKey | WHPCGISTMLQCQL-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 100.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.92 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|