C47H40N6O2 — CID 67813480
3-[2-butyl-1-[[4-phenyl-3-(1-trityltetrazol-5-yl)phenyl]methyl]imidazol-4-yl]benzoic acid (PubChem CID 67813480) has the molecular formula C47H40N6O2 and a molecular weight of 720.88 g/mol. Its IUPAC name is 3-[2-butyl-1-[[4-phenyl-3-(1-trityltetrazol-5-yl)phenyl]methyl]imidazol-4-yl]benzoic acid.
| Compound Name | 3-[2-butyl-1-[[4-phenyl-3-(1-trityltetrazol-5-yl)phenyl]methyl]imidazol-4-yl]benzoic acid |
|---|---|
| PubChem CID | 67813480 |
| Molecular Formula | C47H40N6O2 |
| Molecular Weight | 720.88 g/mol |
| Exact Mass | 720.32 |
| IUPAC Name | 3-[2-butyl-1-[[4-phenyl-3-(1-trityltetrazol-5-yl)phenyl]methyl]imidazol-4-yl]benzoic acid |
| SMILES | CCCCc1nc(-c2cccc(C(=O)O)c2)cn1Cc1ccc(-c2ccccc2)c(-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C47H40N6O2/c1-2-3-27-44-48-43(36-19-16-20-37(31-36)46(54)55)33-52(44)32-34-28-29-41(35-17-8-4-9-18-35)42(30-34)45-49-50-51-53(45)47(38-21-10-5-11-22-38,39-23-12-6-13-24-39)40-25-14-7-15-26-40/h4-26,28-31,33H,2-3,27,32H2,1H3,(H,54,55) |
| InChIKey | BRRPEUQYPOSHEF-UHFFFAOYSA-N |
| XLogP | 9.80 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.88 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|