C47H41N7O3 — CID 10372902
methyl 5-[2-butyl-1-[[4-[4-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-1-oxidopyridin-1-ium-3-carboxylate (PubChem CID 10372902) has the molecular formula C47H41N7O3 and a molecular weight of 751.89 g/mol. Its IUPAC name is methyl 5-[2-butyl-1-[[4-[4-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-1-oxidopyridin-1-ium-3-carboxylate.
| Compound Name | methyl 5-[2-butyl-1-[[4-[4-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-1-oxidopyridin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 10372902 |
| Molecular Formula | C47H41N7O3 |
| Molecular Weight | 751.89 g/mol |
| Exact Mass | 751.33 |
| IUPAC Name | methyl 5-[2-butyl-1-[[4-[4-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-1-oxidopyridin-1-ium-3-carboxylate |
| SMILES | CCCCc1nc(-c2cc(C(=O)OC)c[n+]([O-])c2)cn1Cc1ccc(-c2ccc(-c3nnnn3C(c3ccccc3)(c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C47H41N7O3/c1-3-4-20-44-48-43(38-29-39(46(55)57-2)32-53(56)31-38)33-52(44)30-34-21-23-35(24-22-34)36-25-27-37(28-26-36)45-49-50-51-54(45)47(40-14-8-5-9-15-40,41-16-10-6-11-17-41)42-18-12-7-13-19-42/h5-19,21-29,31-33H,3-4,20,30H2,1-2H3 |
| InChIKey | DWCKVHSTZATAER-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 114.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.89 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|