C27H28N8O — CID 15187693
2-[2-butyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-3,6-dimethyl-1-oxidopyrazin-1-ium (PubChem CID 15187693) has the molecular formula C27H28N8O and a molecular weight of 480.58 g/mol. Its IUPAC name is 2-[2-butyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-3,6-dimethyl-1-oxidopyrazin-1-ium.
| Compound Name | 2-[2-butyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-3,6-dimethyl-1-oxidopyrazin-1-ium |
|---|---|
| PubChem CID | 15187693 |
| Molecular Formula | C27H28N8O |
| Molecular Weight | 480.58 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | 2-[2-butyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]-3,6-dimethyl-1-oxidopyrazin-1-ium |
| SMILES | CCCCc1nc(-c2c(C)ncc(C)[n+]2[O-])cn1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C27H28N8O/c1-4-5-10-25-29-24(26-19(3)28-15-18(2)35(26)36)17-34(25)16-20-11-13-21(14-12-20)22-8-6-7-9-23(22)27-30-32-33-31-27/h6-9,11-15,17H,4-5,10,16H2,1-3H3,(H,30,31,32,33) |
| InChIKey | LTTQZRNKDJRIPL-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 112.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.58 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|